Products 2882206-14-4
CAS 2882206-14-4 is the registry number for Antiproliferative agent-18. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(1-adamantyl)-3-(4-fluorophenyl)-4-(4-methoxyphenyl)-1,3-thiazol-2-imine (CAS 2882206-14-4) is a chemical compound with the molecular formula C26H27FN2OS and a molecular weight of 434.6 g/mol. IUPAC name: N-(1-adamantyl)-3-(4-fluorophenyl)-4-(4-methoxyphenyl)-1,3-thiazol-2-imine. InChIKey: BHDHBEAQJVHRAZ-UHFFFAOYSA-N.
| Molecular formula | C26H27FN2OS |
|---|---|
| Molecular weight | 434.6 g/mol |
| IUPAC name | N-(1-adamantyl)-3-(4-fluorophenyl)-4-(4-methoxyphenyl)-1,3-thiazol-2-imine |
| InChIKey | BHDHBEAQJVHRAZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CSC(=NC34CC5CC(C3)CC(C5)C4)N2C6=CC=C(C=C6)F |
Computed by PubChem (NCBI)
Synonyms:
Antiproliferative agent-18