CAS 2883041-26-5 is the registry number for MASTL-IN-3. Offered by: MedChemExpress. Available pack sizes: 10 mg, 1 mg, 5 mg, 25 mg.
2-N-[2-[1-(difluoromethyl)pyrazol-3-yl]propan-2-yl]-6-(1H-indazol-6-yl)-1,3,5-triazine-2,4-diamine (CAS 2883041-26-5) is a chemical compound with the molecular formula C17H17F2N9 and a molecular weight of 385.4 g/mol. IUPAC name: 2-N-[2-[1-(difluoromethyl)pyrazol-3-yl]propan-2-yl]-6-(1H-indazol-6-yl)-1,3,5-triazine-2,4-diamine. InChIKey: FDVWQBDUVZULDR-UHFFFAOYSA-N.
| Molecular formula | C17H17F2N9 |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | 2-N-[2-[1-(difluoromethyl)pyrazol-3-yl]propan-2-yl]-6-(1H-indazol-6-yl)-1,3,5-triazine-2,4-diamine |
| InChIKey | FDVWQBDUVZULDR-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=NN(C=C1)C(F)F)NC2=NC(=NC(=N2)N)C3=CC4=C(C=C3)C=NN4 |
Computed by PubChem (NCBI)