Products 2883041-36-7
CAS 2883041-36-7 is the registry number for MASTL-IN-4, 99.69%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
2-N-[(2,3-difluorophenyl)methyl]-6-(1H-indazol-6-yl)-1,3,5-triazine-2,4-diamine (CAS 2883041-36-7) is a chemical compound with the molecular formula C17H13F2N7 and a molecular weight of 353.3 g/mol. IUPAC name: 2-N-[(2,3-difluorophenyl)methyl]-6-(1H-indazol-6-yl)-1,3,5-triazine-2,4-diamine. InChIKey: DUQPOQNOAUTKMG-UHFFFAOYSA-N.
| Molecular formula | C17H13F2N7 |
|---|---|
| Molecular weight | 353.3 g/mol |
| IUPAC name | 2-N-[(2,3-difluorophenyl)methyl]-6-(1H-indazol-6-yl)-1,3,5-triazine-2,4-diamine |
| InChIKey | DUQPOQNOAUTKMG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)CNC2=NC(=NC(=N2)N)C3=CC4=C(C=C3)C=NN4 |
Computed by PubChem (NCBI)