CAS 288315-02-6 appears in our catalog under these names: 3,3-Difluoro-1-(diphenylmethyl)azetidine, 95%, 3,3-Difluoro-1-(diphenylmethyl)azetidine, 97%, 97%, 1-Benzhydryl-3,3-difluoroazetidine, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g.
1-benzhydryl-3,3-difluoroazetidine (CAS 288315-02-6) is a chemical compound with the molecular formula C16H15F2N and a molecular weight of 259.29 g/mol. IUPAC name: 1-benzhydryl-3,3-difluoroazetidine. InChIKey: HLEUISXCWOXDRB-UHFFFAOYSA-N.
| Molecular formula | C16H15F2N |
|---|---|
| Molecular weight | 259.29 g/mol |
| IUPAC name | 1-benzhydryl-3,3-difluoroazetidine |
| InChIKey | HLEUISXCWOXDRB-UHFFFAOYSA-N |
| SMILES | C1C(CN1C(C2=CC=CC=C2)C3=CC=CC=C3)(F)F |
Computed by PubChem (NCBI)