CAS 2883430-53-1 is the registry number for Ethyl 4-chloro-5-(1,1-difluoroethyl)-1H-pyrazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4-chloro-5-(1,1-difluoroethyl)-1H-pyrazole-3-carboxylate (CAS 2883430-53-1) is a chemical compound with the molecular formula C8H9ClF2N2O2 and a molecular weight of 238.62 g/mol. IUPAC name: ethyl 4-chloro-5-(1,1-difluoroethyl)-1H-pyrazole-3-carboxylate. InChIKey: FTKCQLDZMKXWMA-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF2N2O2 |
|---|---|
| Molecular weight | 238.62 g/mol |
| IUPAC name | ethyl 4-chloro-5-(1,1-difluoroethyl)-1H-pyrazole-3-carboxylate |
| InChIKey | FTKCQLDZMKXWMA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NNC(=C1Cl)C(C)(F)F |
Computed by PubChem (NCBI)