CAS 2883539-08-8 is the registry number for C5 Lenalidomide-6-fluoro. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(6-amino-5-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 2883539-08-8) is a chemical compound with the molecular formula C13H12FN3O3 and a molecular weight of 277.25 g/mol. IUPAC name: 3-(6-amino-5-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: ISJHHDOFLTULEG-UHFFFAOYSA-N.
| Molecular formula | C13H12FN3O3 |
|---|---|
| Molecular weight | 277.25 g/mol |
| IUPAC name | 3-(6-amino-5-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | ISJHHDOFLTULEG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=CC(=C(C=C3C2=O)F)N |
Computed by PubChem (NCBI)