Products 2883813-66-7
CAS 2883813-66-7 is the registry number for TGFβ1-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-4-(6-piperidin-1-ylhexoxy)benzamide (CAS 2883813-66-7) is a chemical compound with the molecular formula C23H30N4O4S and a molecular weight of 458.6 g/mol. IUPAC name: N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-4-(6-piperidin-1-ylhexoxy)benzamide. InChIKey: BEZBRPCBTXVWAM-HKOYGPOVSA-N.
| Molecular formula | C23H30N4O4S |
|---|---|
| Molecular weight | 458.6 g/mol |
| IUPAC name | N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-4-(6-piperidin-1-ylhexoxy)benzamide |
| InChIKey | BEZBRPCBTXVWAM-HKOYGPOVSA-N |
| SMILES | C1CCN(CC1)CCCCCCOC2=CC=C(C=C2)C(=O)N/N=C/C3=CC=C(S3)[N+](=O)[O-] |
Computed by PubChem (NCBI)