Products 2883822-11-3

CAS 2883822-11-3 is the registry number for trans-2-methylazetidine-3-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

(2S,3R)-2-methylazetidine-3-carboxylic acid (CAS 2883822-11-3) is a chemical compound with the molecular formula C5H9NO2 and a molecular weight of 115.13 g/mol. IUPAC name: (2S,3R)-2-methylazetidine-3-carboxylic acid. InChIKey: FOHVBSWLQDUYRK-IUYQGCFVSA-N.

Identity
Molecular formulaC5H9NO2
Molecular weight115.13 g/mol
IUPAC name(2S,3R)-2-methylazetidine-3-carboxylic acid
InChIKeyFOHVBSWLQDUYRK-IUYQGCFVSA-N
SMILESC[C@H]1[C@@H](CN1)C(=O)O

Computed by PubChem (NCBI)