CAS 2883826-25-1 is the registry number for Ethyl (R)-2-(3-(1-aminoethyl)phenyl)-2,2-difluoroacetate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-[3-[(1R)-1-aminoethyl]phenyl]-2,2-difluoroacetate;hydrochloride (CAS 2883826-25-1) is a chemical compound with the molecular formula C12H16ClF2NO2 and a molecular weight of 279.71 g/mol. IUPAC name: ethyl 2-[3-[(1R)-1-aminoethyl]phenyl]-2,2-difluoroacetate;hydrochloride. InChIKey: SUMGGTQLWNZCSH-DDWIOCJRSA-N.
| Molecular formula | C12H16ClF2NO2 |
|---|---|
| Molecular weight | 279.71 g/mol |
| IUPAC name | ethyl 2-[3-[(1R)-1-aminoethyl]phenyl]-2,2-difluoroacetate;hydrochloride |
| InChIKey | SUMGGTQLWNZCSH-DDWIOCJRSA-N |
| SMILES | CCOC(=O)C(C1=CC=CC(=C1)[C@@H](C)N)(F)F.Cl |
Computed by PubChem (NCBI)