CAS 28845-97-8 appears in our catalog under these names: Ac-lys-d-ala-d-ala-oh, 95%, Ac–Lys–D–Ala–D–Ala–OH, ACETYL-LYS-D-ALA-D-ALA, Acetyl-L-lysyl-D-alanyl-D-alanine, ≥98%, ≥98%, Ac-Lys-D-Ala-D-Ala-OH. Offered by: Combi-blocks, AmBeed, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 100mg, 250mg, 50mg, 10MG, 5mg, 25mg, 5 mg, 10 mg.
(2R)-2-[[(2R)-2-[[(2S)-2-acetamido-6-aminohexanoyl]amino]propanoyl]amino]propanoic acid (CAS 28845-97-8) is a chemical compound with the molecular formula C14H26N4O5 and a molecular weight of 330.38 g/mol. IUPAC name: (2R)-2-[[(2R)-2-[[(2S)-2-acetamido-6-aminohexanoyl]amino]propanoyl]amino]propanoic acid. InChIKey: GMSXMADYKTYBCP-KKZNHRDASA-N.
| Molecular formula | C14H26N4O5 |
|---|---|
| Molecular weight | 330.38 g/mol |
| IUPAC name | (2R)-2-[[(2R)-2-[[(2S)-2-acetamido-6-aminohexanoyl]amino]propanoyl]amino]propanoic acid |
| InChIKey | GMSXMADYKTYBCP-KKZNHRDASA-N |
| SMILES | C[C@H](C(=O)N[C@H](C)C(=O)O)NC(=O)[C@H](CCCCN)NC(=O)C |
Computed by PubChem (NCBI)