CAS 2885273-55-0 is the registry number for 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-en-1-yl benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enyl] benzoate (CAS 2885273-55-0) is a chemical compound with the molecular formula C19H27BO4 and a molecular weight of 330.2 g/mol. IUPAC name: [(E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enyl] benzoate. InChIKey: XPWLZEZRPIMKMC-GXDHUFHOSA-N.
| Molecular formula | C19H27BO4 |
|---|---|
| Molecular weight | 330.2 g/mol |
| IUPAC name | [(E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enyl] benzoate |
| InChIKey | XPWLZEZRPIMKMC-GXDHUFHOSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/CCCCOC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)