CAS 2886002-32-8 is the registry number for 6-Iodo-1,1,5-trimethyl-1,3-dihydroisobenzofuran, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-iodo-3,3,6-trimethyl-1H-2-benzofuran (CAS 2886002-32-8) is a chemical compound with the molecular formula C11H13IO and a molecular weight of 288.12 g/mol. IUPAC name: 5-iodo-3,3,6-trimethyl-1H-2-benzofuran. InChIKey: IFMMYCINCRKJBG-UHFFFAOYSA-N.
| Molecular formula | C11H13IO |
|---|---|
| Molecular weight | 288.12 g/mol |
| IUPAC name | 5-iodo-3,3,6-trimethyl-1H-2-benzofuran |
| InChIKey | IFMMYCINCRKJBG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1I)C(OC2)(C)C |
Computed by PubChem (NCBI)