CAS 28861-00-9 is the registry number for N-(Aminocarbonyl)-L-α-Methyl DOPA. Offered by: TRC. Available pack sizes: 2,5g.
(2S)-2-(carbamoylamino)-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid (CAS 28861-00-9) is a chemical compound with the molecular formula C13H18N2O5 and a molecular weight of 282.29 g/mol. IUPAC name: (2S)-2-(carbamoylamino)-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid. InChIKey: ZAWWRCDFZPMIQT-ZDUSSCGKSA-N.
| Molecular formula | C13H18N2O5 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | (2S)-2-(carbamoylamino)-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid |
| InChIKey | ZAWWRCDFZPMIQT-ZDUSSCGKSA-N |
| SMILES | C[C@](CC1=CC(=C(C=C1)OC)OC)(C(=O)O)NC(=O)N |
Computed by PubChem (NCBI)