CAS 288628-95-5 is the registry number for N,N,N',N'-Tetramethyl-4-fluorophenylphosphonodiamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[dimethylamino-(4-fluorophenyl)phosphoryl]-N-methylmethanamine (CAS 288628-95-5) is a chemical compound with the molecular formula C10H16FN2OP and a molecular weight of 230.22 g/mol. IUPAC name: N-[dimethylamino-(4-fluorophenyl)phosphoryl]-N-methylmethanamine. InChIKey: UZLLXEYAFHVXEZ-UHFFFAOYSA-N.
| Molecular formula | C10H16FN2OP |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | N-[dimethylamino-(4-fluorophenyl)phosphoryl]-N-methylmethanamine |
| InChIKey | UZLLXEYAFHVXEZ-UHFFFAOYSA-N |
| SMILES | CN(C)P(=O)(C1=CC=C(C=C1)F)N(C)C |
Computed by PubChem (NCBI)