Products 2887531-10-2
CAS 2887531-10-2 is the registry number for (S)-1-(3,5-Dichloro-2-methylpyridin-4-yl)ethyl methanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S)-1-(3,5-dichloro-2-methyl-4-pyridinyl)ethyl] methanesulfonate (CAS 2887531-10-2) is a chemical compound with the molecular formula C9H11Cl2NO3S and a molecular weight of 284.16 g/mol. IUPAC name: [(1S)-1-(3,5-dichloro-2-methyl-4-pyridinyl)ethyl] methanesulfonate. InChIKey: STDKTOSCQDGNMB-LURJTMIESA-N.
| Molecular formula | C9H11Cl2NO3S |
|---|---|
| Molecular weight | 284.16 g/mol |
| IUPAC name | [(1S)-1-(3,5-dichloro-2-methyl-4-pyridinyl)ethyl] methanesulfonate |
| InChIKey | STDKTOSCQDGNMB-LURJTMIESA-N |
| SMILES | CC1=NC=C(C(=C1Cl)[C@H](C)OS(=O)(=O)C)Cl |
Computed by PubChem (NCBI)