CAS 2887613-13-8 appears in our catalog under these names: 7-(4-Bromo-3-fluoro-2-methylphenoxy)-[1,2,4]triazolo[1,5-a]pyridine, 7-(4-Bromo-3-fluoro-2-methylphenoxy)[1,2,4]triazolo[1,5-a]pyridine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
7-(4-bromo-3-fluoro-2-methylphenoxy)-[1,2,4]triazolo[1,5-a]pyridine (CAS 2887613-13-8) is a chemical compound with the molecular formula C13H9BrFN3O and a molecular weight of 322.13 g/mol. IUPAC name: 7-(4-bromo-3-fluoro-2-methylphenoxy)-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: YCQLLJWDWVGALX-UHFFFAOYSA-N.
| Molecular formula | C13H9BrFN3O |
|---|---|
| Molecular weight | 322.13 g/mol |
| IUPAC name | 7-(4-bromo-3-fluoro-2-methylphenoxy)-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | YCQLLJWDWVGALX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1F)Br)OC2=CC3=NC=NN3C=C2 |
Computed by PubChem (NCBI)