CAS 288853-63-4 is the registry number for 5-Hydroxy Rosiglitazone Sulfate. Offered by: TRC. Available pack sizes: 1mg.
[6-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl-methylamino]-3-pyridinyl] hydrogen sulfate (CAS 288853-63-4) is a chemical compound with the molecular formula C18H19N3O7S2 and a molecular weight of 453.5 g/mol. IUPAC name: [6-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl-methylamino]-3-pyridinyl] hydrogen sulfate. InChIKey: WAGUBJKZLRLKGR-UHFFFAOYSA-N.
| Molecular formula | C18H19N3O7S2 |
|---|---|
| Molecular weight | 453.5 g/mol |
| IUPAC name | [6-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl-methylamino]-3-pyridinyl] hydrogen sulfate |
| InChIKey | WAGUBJKZLRLKGR-UHFFFAOYSA-N |
| SMILES | CN(CCOC1=CC=C(C=C1)CC2C(=O)NC(=O)S2)C3=NC=C(C=C3)OS(=O)(=O)O |
Computed by PubChem (NCBI)