CAS 2890-60-0 is the registry number for 1-Phenyl-cyclohexanecarboxylic acid amide, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
1-phenylcyclohexane-1-carboxamide (CAS 2890-60-0) is a chemical compound with the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. IUPAC name: 1-phenylcyclohexane-1-carboxamide. InChIKey: RKNUEXASLVLVSL-UHFFFAOYSA-N.
| Molecular formula | C13H17NO |
|---|---|
| Molecular weight | 203.28 g/mol |
| IUPAC name | 1-phenylcyclohexane-1-carboxamide |
| InChIKey | RKNUEXASLVLVSL-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC=CC=C2)C(=O)N |
Computed by PubChem (NCBI)