Products 2890191-41-8
CAS 2890191-41-8 appears in our catalog under these names: AZD4144, 99.67%, AZD4144, 98%. Offered by: MedChemExpress, Ambeed. Available pack sizes: 50 mg, 100 mg, 25 mg, 5 mg, 10 mg, 50mg, 100mg, 250mg.
(2S)-3-[[4-[2-hydroxy-4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]propane-1,2-diol (CAS 2890191-41-8) is a chemical compound with the molecular formula C18H16F3N3O3 and a molecular weight of 379.3 g/mol. IUPAC name: (2S)-3-[[4-[2-hydroxy-4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]propane-1,2-diol. InChIKey: CEGVLCNHZDUFIJ-NSHDSACASA-N.
| Molecular formula | C18H16F3N3O3 |
|---|---|
| Molecular weight | 379.3 g/mol |
| IUPAC name | (2S)-3-[[4-[2-hydroxy-4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]propane-1,2-diol |
| InChIKey | CEGVLCNHZDUFIJ-NSHDSACASA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN=C2NC[C@@H](CO)O)C3=C(C=C(C=C3)C(F)(F)F)O |
Computed by PubChem (NCBI)