Products 2890221-26-6
CAS 2890221-26-6 is the registry number for sEH inhibitor-14. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(2-oxo-3H-1,3-benzoxazol-5-yl)-3-[[2-(trifluoromethoxy)phenyl]methyl]urea (CAS 2890221-26-6) is a chemical compound with the molecular formula C16H12F3N3O4 and a molecular weight of 367.28 g/mol. IUPAC name: 1-(2-oxo-3H-1,3-benzoxazol-5-yl)-3-[[2-(trifluoromethoxy)phenyl]methyl]urea. InChIKey: IBPYKXOYNPPXBW-UHFFFAOYSA-N.
| Molecular formula | C16H12F3N3O4 |
|---|---|
| Molecular weight | 367.28 g/mol |
| IUPAC name | 1-(2-oxo-3H-1,3-benzoxazol-5-yl)-3-[[2-(trifluoromethoxy)phenyl]methyl]urea |
| InChIKey | IBPYKXOYNPPXBW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNC(=O)NC2=CC3=C(C=C2)OC(=O)N3)OC(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
sEH inhibitor-14, orb1744729