CAS 2890631-04-4 is the registry number for (S)-2-Bromo-7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(7S)-2-bromo-7-methyl-5,6-dihydrocyclopenta[b]pyridin-7-ol (CAS 2890631-04-4) is a chemical compound with the molecular formula C9H10BrNO and a molecular weight of 228.09 g/mol. IUPAC name: (7S)-2-bromo-7-methyl-5,6-dihydrocyclopenta[b]pyridin-7-ol. InChIKey: OHDGOLTYTDKRAZ-VIFPVBQESA-N.
| Molecular formula | C9H10BrNO |
|---|---|
| Molecular weight | 228.09 g/mol |
| IUPAC name | (7S)-2-bromo-7-methyl-5,6-dihydrocyclopenta[b]pyridin-7-ol |
| InChIKey | OHDGOLTYTDKRAZ-VIFPVBQESA-N |
| SMILES | C[C@@]1(CCC2=C1N=C(C=C2)Br)O |
Computed by PubChem (NCBI)