Products 2890775-71-8
CAS 2890775-71-8 is the registry number for (S)-1-(2-Methoxy-4-((trimethylsilyl)ethynyl)phenyl)ethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-[2-methoxy-4-(2-trimethylsilylethynyl)phenyl]ethanamine (CAS 2890775-71-8) is a chemical compound with the molecular formula C14H21NOSi and a molecular weight of 247.41 g/mol. IUPAC name: (1S)-1-[2-methoxy-4-(2-trimethylsilylethynyl)phenyl]ethanamine. InChIKey: XIGHCTIMUCYSFS-NSHDSACASA-N.
| Molecular formula | C14H21NOSi |
|---|---|
| Molecular weight | 247.41 g/mol |
| IUPAC name | (1S)-1-[2-methoxy-4-(2-trimethylsilylethynyl)phenyl]ethanamine |
| InChIKey | XIGHCTIMUCYSFS-NSHDSACASA-N |
| SMILES | C[C@@H](C1=C(C=C(C=C1)C#C[Si](C)(C)C)OC)N |
Computed by PubChem (NCBI)