CAS 2890779-96-9 is the registry number for (4-Ethynyl-3,5-difluorophenyl)methanamine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-ethynyl-3,5-difluorophenyl)methanamine;hydrochloride (CAS 2890779-96-9) is a chemical compound with the molecular formula C9H8ClF2N and a molecular weight of 203.61 g/mol. IUPAC name: (4-ethynyl-3,5-difluorophenyl)methanamine;hydrochloride. InChIKey: BEWIKUXKEDKJAZ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF2N |
|---|---|
| Molecular weight | 203.61 g/mol |
| IUPAC name | (4-ethynyl-3,5-difluorophenyl)methanamine;hydrochloride |
| InChIKey | BEWIKUXKEDKJAZ-UHFFFAOYSA-N |
| SMILES | C#CC1=C(C=C(C=C1F)CN)F.Cl |
Computed by PubChem (NCBI)