CAS 28910-91-0 appears in our catalog under these names: 8-Chloro-6-(2-fluorophenyl)-1-methyl-4H-(1,2,4)triazolo(4,3-a)(1,4)benzodiazepine, Flualprazolam, Flualprazolam, 1mg/ml in Methanol, Flualprazolam solution, 1 mg/mL in methanol. Offered by: TRC, Lipomed, Biosynth, Sigma-Aldrich. Available pack sizes: 25mg, 50mg, 100mg, 10mg, 1ml, 0,25ml, 0,25mg, 0,5ml.
8-chloro-6-(2-fluorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (CAS 28910-91-0) is a chemical compound with the molecular formula C17H12ClFN4 and a molecular weight of 326.8 g/mol. IUPAC name: 8-chloro-6-(2-fluorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine. InChIKey: MPZVLJCMGPYWQQ-UHFFFAOYSA-N.
| Molecular formula | C17H12ClFN4 |
|---|---|
| Molecular weight | 326.8 g/mol |
| IUPAC name | 8-chloro-6-(2-fluorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| InChIKey | MPZVLJCMGPYWQQ-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1C3=C(C=C(C=C3)Cl)C(=NC2)C4=CC=CC=C4F |
Computed by PubChem (NCBI)