CAS 28910-99-8 appears in our catalog under these names: Nitrazolam, Nitrazolam (1.0 mg/mL in Methanol). Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 250mg, 1x1ml, 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg.
1-methyl-8-nitro-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (CAS 28910-99-8) is a chemical compound with the molecular formula C17H13N5O2 and a molecular weight of 319.32 g/mol. IUPAC name: 1-methyl-8-nitro-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine. InChIKey: OYRPNABWTHDOFK-UHFFFAOYSA-N.
| Molecular formula | C17H13N5O2 |
|---|---|
| Molecular weight | 319.32 g/mol |
| IUPAC name | 1-methyl-8-nitro-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| InChIKey | OYRPNABWTHDOFK-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1C3=C(C=C(C=C3)[N+](=O)[O-])C(=NC2)C4=CC=CC=C4 |
Computed by PubChem (NCBI)