CAS 2891581-24-9 is the registry number for (3R,4S)-4-Fluoro-1-(phenylmethyl)-3-piperidinol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(3R,4S)-1-benzyl-4-fluoropiperidin-3-ol (CAS 2891581-24-9) is a chemical compound with the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. IUPAC name: (3R,4S)-1-benzyl-4-fluoropiperidin-3-ol. InChIKey: GGXXTHAKPKIUMB-NWDGAFQWSA-N.
| Molecular formula | C12H16FNO |
|---|---|
| Molecular weight | 209.26 g/mol |
| IUPAC name | (3R,4S)-1-benzyl-4-fluoropiperidin-3-ol |
| InChIKey | GGXXTHAKPKIUMB-NWDGAFQWSA-N |
| SMILES | C1CN(C[C@H]([C@H]1F)O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)