Products 2891581-51-2
CAS 2891581-51-2 is the registry number for tert-butyl (3R)-3-(trans-4-aminocyclohexyl)pyrrolidine-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (3R)-3-(4-aminocyclohexyl)pyrrolidine-1-carboxylate (CAS 2891581-51-2) is a chemical compound with the molecular formula C15H28N2O2 and a molecular weight of 268.39 g/mol. IUPAC name: tert-butyl (3R)-3-(4-aminocyclohexyl)pyrrolidine-1-carboxylate. InChIKey: KONFVZYBQGPQNO-CPCZMJQVSA-N.
| Molecular formula | C15H28N2O2 |
|---|---|
| Molecular weight | 268.39 g/mol |
| IUPAC name | tert-butyl (3R)-3-(4-aminocyclohexyl)pyrrolidine-1-carboxylate |
| InChIKey | KONFVZYBQGPQNO-CPCZMJQVSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C1)C2CCC(CC2)N |
Computed by PubChem (NCBI)