CAS 2891597-93-4 appears in our catalog under these names: 3-(2,4-Difluorobenzyl)azetidine 2,2,2-trifluoroacetate, 98%, 3-[(2,4-difluorophenyl)methyl]azetidine,2,2,2-trifluoroacetic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
3-[(2,4-difluorophenyl)methyl]azetidine;2,2,2-trifluoroacetic acid (CAS 2891597-93-4) is a chemical compound with the molecular formula C12H12F5NO2 and a molecular weight of 297.22 g/mol. IUPAC name: 3-[(2,4-difluorophenyl)methyl]azetidine;2,2,2-trifluoroacetic acid. InChIKey: WUUIPHOKSXJZLZ-UHFFFAOYSA-N.
| Molecular formula | C12H12F5NO2 |
|---|---|
| Molecular weight | 297.22 g/mol |
| IUPAC name | 3-[(2,4-difluorophenyl)methyl]azetidine;2,2,2-trifluoroacetic acid |
| InChIKey | WUUIPHOKSXJZLZ-UHFFFAOYSA-N |
| SMILES | C1C(CN1)CC2=C(C=C(C=C2)F)F.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)