Products 2891597-98-9
CAS 2891597-98-9 is the registry number for ethyl 3-(1-tert-butoxycarbonylazetidin-3-yl)-1H-pyrrole-2-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Ethyl 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]-1H-pyrrole-2-carboxylate (CAS 2891597-98-9) is a chemical compound with the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. IUPAC name: ethyl 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]-1H-pyrrole-2-carboxylate. InChIKey: NBLYGVUMHXSEOR-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O4 |
|---|---|
| Molecular weight | 294.35 g/mol |
| IUPAC name | ethyl 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]-1H-pyrrole-2-carboxylate |
| InChIKey | NBLYGVUMHXSEOR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CN1)C2CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)