CAS 2891598-15-3 is the registry number for 6-Thia-1-azaspiro(3.3)heptane 6,6-dioxide 2,2,2-trifluoroacetate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg, 5g.
6lambda6-thia-1-azaspiro[3.3]heptane 6,6-dioxide;2,2,2-trifluoroacetic acid (CAS 2891598-15-3) is a chemical compound with the molecular formula C7H10F3NO4S and a molecular weight of 261.22 g/mol. IUPAC name: 6lambda6-thia-1-azaspiro[3.3]heptane 6,6-dioxide;2,2,2-trifluoroacetic acid. InChIKey: QVMMHHLQTTXMBL-UHFFFAOYSA-N.
| Molecular formula | C7H10F3NO4S |
|---|---|
| Molecular weight | 261.22 g/mol |
| IUPAC name | 6lambda6-thia-1-azaspiro[3.3]heptane 6,6-dioxide;2,2,2-trifluoroacetic acid |
| InChIKey | QVMMHHLQTTXMBL-UHFFFAOYSA-N |
| SMILES | C1CNC12CS(=O)(=O)C2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)