Products 2891598-26-6

CAS 2891598-26-6 is the registry number for 3-bromo-7-methyl-5H-pyrrolo[2,3-b]pyrazine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

3-bromo-7-methyl-5H-pyrrolo[2,3-b]pyrazine (CAS 2891598-26-6) is a chemical compound with the molecular formula C7H6BrN3 and a molecular weight of 212.05 g/mol. IUPAC name: 3-bromo-7-methyl-5H-pyrrolo[2,3-b]pyrazine. InChIKey: BQPYVAKYAJOHMK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6BrN3
Molecular weight212.05 g/mol
IUPAC name3-bromo-7-methyl-5H-pyrrolo[2,3-b]pyrazine
InChIKeyBQPYVAKYAJOHMK-UHFFFAOYSA-N
SMILESCC1=CNC2=NC(=CN=C12)Br

Computed by PubChem (NCBI)