CAS 2891598-69-7 is the registry number for 4-(3-amino-2,2,4,4-tetramethyl-cyclobutoxy)-2-chloro-benzonitrile,hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
4-(3-amino-2,2,4,4-tetramethylcyclobutyl)oxy-2-chlorobenzonitrile;hydrochloride (CAS 2891598-69-7) is a chemical compound with the molecular formula C15H20Cl2N2O and a molecular weight of 315.2 g/mol. IUPAC name: 4-(3-amino-2,2,4,4-tetramethylcyclobutyl)oxy-2-chlorobenzonitrile;hydrochloride. InChIKey: SHISKTDDIFARGI-UHFFFAOYSA-N.
| Molecular formula | C15H20Cl2N2O |
|---|---|
| Molecular weight | 315.2 g/mol |
| IUPAC name | 4-(3-amino-2,2,4,4-tetramethylcyclobutyl)oxy-2-chlorobenzonitrile;hydrochloride |
| InChIKey | SHISKTDDIFARGI-UHFFFAOYSA-N |
| SMILES | CC1(C(C(C1OC2=CC(=C(C=C2)C#N)Cl)(C)C)N)C.Cl |
Computed by PubChem (NCBI)