CAS 2891598-85-7 appears in our catalog under these names: 5-Amino-3-(2-methoxy-2-oxoethyl)-1-methyl-1H-pyrazole-4-carboxylic acid hydrochloride, 98%, 5-Amino-3-(2-methoxy-2-oxoethyl)-1-methyl-1H-pyrazole-4-carboxylic Acid Hydrochloride, ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g.
5-amino-3-(2-methoxy-2-oxoethyl)-1-methylpyrazole-4-carboxylic acid;hydrochloride (CAS 2891598-85-7) is a chemical compound with the molecular formula C8H12ClN3O4 and a molecular weight of 249.65 g/mol. IUPAC name: 5-amino-3-(2-methoxy-2-oxoethyl)-1-methylpyrazole-4-carboxylic acid;hydrochloride. InChIKey: DFIXKZJSZPZKIO-UHFFFAOYSA-N.
| Molecular formula | C8H12ClN3O4 |
|---|---|
| Molecular weight | 249.65 g/mol |
| IUPAC name | 5-amino-3-(2-methoxy-2-oxoethyl)-1-methylpyrazole-4-carboxylic acid;hydrochloride |
| InChIKey | DFIXKZJSZPZKIO-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=N1)CC(=O)OC)C(=O)O)N.Cl |
Computed by PubChem (NCBI)