CAS 2891599-07-6 is the registry number for 7-bromo-2-chloro-pyrrolo[2,1-f][1,2,4]triazine-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-2-chloropyrrolo[2,1-f][1,2,4]triazine-5-carboxylic acid (CAS 2891599-07-6) is a chemical compound with the molecular formula C7H3BrClN3O2 and a molecular weight of 276.47 g/mol. IUPAC name: 7-bromo-2-chloropyrrolo[2,1-f][1,2,4]triazine-5-carboxylic acid. InChIKey: RRUWJSZFXAFZIY-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClN3O2 |
|---|---|
| Molecular weight | 276.47 g/mol |
| IUPAC name | 7-bromo-2-chloropyrrolo[2,1-f][1,2,4]triazine-5-carboxylic acid |
| InChIKey | RRUWJSZFXAFZIY-UHFFFAOYSA-N |
| SMILES | C1=C(N2C(=C1C(=O)O)C=NC(=N2)Cl)Br |
Computed by PubChem (NCBI)