CAS 2891599-32-7 is the registry number for 1-(4-bromophenyl)cyclopropanesulfinic acid,sodium salt, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
CAS 2891599-32-7 identifies a chemical compound with the molecular formula C9H9BrNaO2S and a molecular weight of 284.13 g/mol. InChIKey: HEDSLBXKCYUHCK-UHFFFAOYSA-N.
| Molecular formula | C9H9BrNaO2S |
|---|---|
| Molecular weight | 284.13 g/mol |
| InChIKey | HEDSLBXKCYUHCK-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=C(C=C2)Br)S(=O)O.[Na] |
Computed by PubChem (NCBI)