Products 2891908-18-0

CAS 2891908-18-0 is the registry number for 7-Imino-7λ6-thiaspiro[3.5]nonane 7-oxide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

7-imino-7lambda6-thiaspiro[3.5]nonane 7-oxide (CAS 2891908-18-0) is a chemical compound with the molecular formula C8H15NOS and a molecular weight of 173.28 g/mol. IUPAC name: 7-imino-7lambda6-thiaspiro[3.5]nonane 7-oxide. InChIKey: IACBRIVWXRTWBQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15NOS
Molecular weight173.28 g/mol
IUPAC name7-imino-7lambda6-thiaspiro[3.5]nonane 7-oxide
InChIKeyIACBRIVWXRTWBQ-UHFFFAOYSA-N
SMILESC1CC2(C1)CCS(=N)(=O)CC2

Computed by PubChem (NCBI)