Products 2891984-12-4
CAS 2891984-12-4 is the registry number for Anticancer agent 258. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(3-fluorophenyl)-2-(4-fluorophenyl)-4-methylimidazo[1,2-b][1,2,4]triazole (CAS 2891984-12-4) is a chemical compound with the molecular formula C17H12F2N4 and a molecular weight of 310.30 g/mol. IUPAC name: 5-(3-fluorophenyl)-2-(4-fluorophenyl)-4-methylimidazo[1,2-b][1,2,4]triazole. InChIKey: DKWLKCTUPKUGSM-UHFFFAOYSA-N.
| Molecular formula | C17H12F2N4 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | 5-(3-fluorophenyl)-2-(4-fluorophenyl)-4-methylimidazo[1,2-b][1,2,4]triazole |
| InChIKey | DKWLKCTUPKUGSM-UHFFFAOYSA-N |
| SMILES | CN1C(=CN2C1=NC(=N2)C3=CC=C(C=C3)F)C4=CC(=CC=C4)F |
Computed by PubChem (NCBI)
Synonyms:
Anticancer agent 258, orb2814596