CAS 2891993-34-1 is the registry number for Methyl 4-amino-2,6-dichloro-5-fluoronicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-amino-2,6-dichloro-5-fluoropyridine-3-carboxylate (CAS 2891993-34-1) is a chemical compound with the molecular formula C7H5Cl2FN2O2 and a molecular weight of 239.03 g/mol. IUPAC name: methyl 4-amino-2,6-dichloro-5-fluoropyridine-3-carboxylate. InChIKey: IEBVVSVTPOAXLB-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2FN2O2 |
|---|---|
| Molecular weight | 239.03 g/mol |
| IUPAC name | methyl 4-amino-2,6-dichloro-5-fluoropyridine-3-carboxylate |
| InChIKey | IEBVVSVTPOAXLB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(N=C1Cl)Cl)F)N |
Computed by PubChem (NCBI)