CAS 2892012-01-8 is the registry number for ((3AS,7aR,8aS)-octahydrocyclopenta[b]pyrrolizin-7a(5H)-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(3aS,7aR,8aS)-2,3,3a,5,6,7,8,8a-octahydro-1H-cyclopenta[b]pyrrolizin-7a-yl]methanol (CAS 2892012-01-8) is a chemical compound with the molecular formula C11H19NO and a molecular weight of 181.27 g/mol. IUPAC name: [(3aS,7aR,8aS)-2,3,3a,5,6,7,8,8a-octahydro-1H-cyclopenta[b]pyrrolizin-7a-yl]methanol. InChIKey: MQKBGBJOESQCQH-GARJFASQSA-N.
| Molecular formula | C11H19NO |
|---|---|
| Molecular weight | 181.27 g/mol |
| IUPAC name | [(3aS,7aR,8aS)-2,3,3a,5,6,7,8,8a-octahydro-1H-cyclopenta[b]pyrrolizin-7a-yl]methanol |
| InChIKey | MQKBGBJOESQCQH-GARJFASQSA-N |
| SMILES | C1C[C@H]2C[C@]3(CCCN3[C@H]2C1)CO |
Computed by PubChem (NCBI)