CAS 2892065-49-3 is the registry number for (S,S)-PLX-4545, 96.09%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 10 mg, 25 mg, 5 mg.
3-[3-oxo-6-[(1S,2S)-2-(3-phenylazetidin-1-yl)cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione (CAS 2892065-49-3) is a chemical compound with the molecular formula C28H31N3O4 and a molecular weight of 473.6 g/mol. IUPAC name: 3-[3-oxo-6-[(1S,2S)-2-(3-phenylazetidin-1-yl)cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione. InChIKey: DQYZQRGRHXEYPT-PFIFLBKHSA-N.
| Molecular formula | C28H31N3O4 |
|---|---|
| Molecular weight | 473.6 g/mol |
| IUPAC name | 3-[3-oxo-6-[(1S,2S)-2-(3-phenylazetidin-1-yl)cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
| InChIKey | DQYZQRGRHXEYPT-PFIFLBKHSA-N |
| SMILES | C1CC[C@@H]([C@H](C1)N2CC(C2)C3=CC=CC=C3)OC4=CC5=C(C=C4)C(=O)N(C5)C6CCC(=O)NC6=O |
Computed by PubChem (NCBI)