Products 2892253-27-7
CAS 2892253-27-7 is the registry number for 6'-(Trifluoromethyl)-1'H-spiro[cyclopropane-1,4'-isoquinoline]-1',3'(2'H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6'-(trifluoromethyl)spiro[cyclopropane-1,4'-isoquinoline]-1',3'-dione (CAS 2892253-27-7) is a chemical compound with the molecular formula C12H8F3NO2 and a molecular weight of 255.19 g/mol. IUPAC name: 6'-(trifluoromethyl)spiro[cyclopropane-1,4'-isoquinoline]-1',3'-dione. InChIKey: DQFFQAWZBFPASZ-UHFFFAOYSA-N.
| Molecular formula | C12H8F3NO2 |
|---|---|
| Molecular weight | 255.19 g/mol |
| IUPAC name | 6'-(trifluoromethyl)spiro[cyclopropane-1,4'-isoquinoline]-1',3'-dione |
| InChIKey | DQFFQAWZBFPASZ-UHFFFAOYSA-N |
| SMILES | C1CC12C3=C(C=CC(=C3)C(F)(F)F)C(=O)NC2=O |
Computed by PubChem (NCBI)