CAS 2892290-46-7 is the registry number for (S)-3,3-Dimethyl-2-(2,2,2-trifluoroacetamido)pent-4-ynoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-ynoic acid (CAS 2892290-46-7) is a chemical compound with the molecular formula C9H10F3NO3 and a molecular weight of 237.18 g/mol. IUPAC name: (2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-ynoic acid. InChIKey: XUFPRBISMPJGFX-RXMQYKEDSA-N.
| Molecular formula | C9H10F3NO3 |
|---|---|
| Molecular weight | 237.18 g/mol |
| IUPAC name | (2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-ynoic acid |
| InChIKey | XUFPRBISMPJGFX-RXMQYKEDSA-N |
| SMILES | CC(C)(C#C)[C@@H](C(=O)O)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)