Products 2892449-72-6

CAS 2892449-72-6 is the registry number for 7-Imino-2-oxa-7l6-thiaspiro[3.5]nonane 7-oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

7-imino-2-oxa-7lambda6-thiaspiro[3.5]nonane 7-oxide (CAS 2892449-72-6) is a chemical compound with the molecular formula C7H13NO2S and a molecular weight of 175.25 g/mol. IUPAC name: 7-imino-2-oxa-7lambda6-thiaspiro[3.5]nonane 7-oxide. InChIKey: XLMJRMLSFKXENV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13NO2S
Molecular weight175.25 g/mol
IUPAC name7-imino-2-oxa-7lambda6-thiaspiro[3.5]nonane 7-oxide
InChIKeyXLMJRMLSFKXENV-UHFFFAOYSA-N
SMILESC1CS(=N)(=O)CCC12COC2

Computed by PubChem (NCBI)