CAS 2892522-81-3 is the registry number for tert-Butyl 4-(5-aminoisoxazol-3-yl)-4-fluoropiperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-(5-amino-1,2-oxazol-3-yl)-4-fluoropiperidine-1-carboxylate (CAS 2892522-81-3) is a chemical compound with the molecular formula C13H20FN3O3 and a molecular weight of 285.31 g/mol. IUPAC name: tert-butyl 4-(5-amino-1,2-oxazol-3-yl)-4-fluoropiperidine-1-carboxylate. InChIKey: RMRJZNBJTLUWDW-UHFFFAOYSA-N.
| Molecular formula | C13H20FN3O3 |
|---|---|
| Molecular weight | 285.31 g/mol |
| IUPAC name | tert-butyl 4-(5-amino-1,2-oxazol-3-yl)-4-fluoropiperidine-1-carboxylate |
| InChIKey | RMRJZNBJTLUWDW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C2=NOC(=C2)N)F |
Computed by PubChem (NCBI)