CAS 28926-65-0 appears in our catalog under these names: 1,1,1-Tris(diphenylphosphino)methane, 95%, 1,1,1-Tris(diphenylphosphino)methane, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g.
Bis(diphenylphosphanyl)methyl-diphenylphosphane (CAS 28926-65-0) is a chemical compound with the molecular formula C37H31P3 and a molecular weight of 568.6 g/mol. IUPAC name: bis(diphenylphosphanyl)methyl-diphenylphosphane. InChIKey: KYDFRUPZLLIHQE-UHFFFAOYSA-N.
| Molecular formula | C37H31P3 |
|---|---|
| Molecular weight | 568.6 g/mol |
| IUPAC name | bis(diphenylphosphanyl)methyl-diphenylphosphane |
| InChIKey | KYDFRUPZLLIHQE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C(P(C3=CC=CC=C3)C4=CC=CC=C4)P(C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)