CAS 2893778-31-7 appears in our catalog under these names: PHGDH-IN-3, 98%, PHGDH-IN-3/ 99.47% (existing batch purity), PHGDH–IN–3, PHGDH-IN-3 99%, PHGDH-IN-3. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
4-[(3-acetylphenyl)sulfamoyl]-N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]benzamide (CAS 2893778-31-7) is a chemical compound with the molecular formula C24H18FN3O4S2 and a molecular weight of 495.5 g/mol. IUPAC name: 4-[(3-acetylphenyl)sulfamoyl]-N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]benzamide. InChIKey: VUAMLKVINZWIJR-UHFFFAOYSA-N.
| Molecular formula | C24H18FN3O4S2 |
|---|---|
| Molecular weight | 495.5 g/mol |
| IUPAC name | 4-[(3-acetylphenyl)sulfamoyl]-N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]benzamide |
| InChIKey | VUAMLKVINZWIJR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)NS(=O)(=O)C2=CC=C(C=C2)C(=O)NC3=NC(=CS3)C4=CC(=CC=C4)F |
Computed by PubChem (NCBI)