CAS 2893970-51-7 is the registry number for 6-Benzyl-1,4-dichloro-5,6,7,8-tetrahydropyrido[3,4-d]pyridazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-benzyl-1,4-dichloro-7,8-dihydro-5H-pyrido[3,4-d]pyridazine (CAS 2893970-51-7) is a chemical compound with the molecular formula C14H13Cl2N3 and a molecular weight of 294.2 g/mol. IUPAC name: 6-benzyl-1,4-dichloro-7,8-dihydro-5H-pyrido[3,4-d]pyridazine. InChIKey: WBPAPMUBMUTGRY-UHFFFAOYSA-N.
| Molecular formula | C14H13Cl2N3 |
|---|---|
| Molecular weight | 294.2 g/mol |
| IUPAC name | 6-benzyl-1,4-dichloro-7,8-dihydro-5H-pyrido[3,4-d]pyridazine |
| InChIKey | WBPAPMUBMUTGRY-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1C(=NN=C2Cl)Cl)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)