CAS 2893971-66-7 is the registry number for 4-(Ethoxycarbonyl)-2,2-dimethyl-2,5-dihydrothiophene-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-ethoxycarbonyl-5,5-dimethyl-2H-thiophene-4-carboxylic acid (CAS 2893971-66-7) is a chemical compound with the molecular formula C10H14O4S and a molecular weight of 230.28 g/mol. IUPAC name: 3-ethoxycarbonyl-5,5-dimethyl-2H-thiophene-4-carboxylic acid. InChIKey: VVWNLHGQSPEKEH-UHFFFAOYSA-N.
| Molecular formula | C10H14O4S |
|---|---|
| Molecular weight | 230.28 g/mol |
| IUPAC name | 3-ethoxycarbonyl-5,5-dimethyl-2H-thiophene-4-carboxylic acid |
| InChIKey | VVWNLHGQSPEKEH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(SC1)(C)C)C(=O)O |
Computed by PubChem (NCBI)