Products 2893971-66-7

CAS 2893971-66-7 is the registry number for 4-(Ethoxycarbonyl)-2,2-dimethyl-2,5-dihydrothiophene-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-ethoxycarbonyl-5,5-dimethyl-2H-thiophene-4-carboxylic acid (CAS 2893971-66-7) is a chemical compound with the molecular formula C10H14O4S and a molecular weight of 230.28 g/mol. IUPAC name: 3-ethoxycarbonyl-5,5-dimethyl-2H-thiophene-4-carboxylic acid. InChIKey: VVWNLHGQSPEKEH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14O4S
Molecular weight230.28 g/mol
IUPAC name3-ethoxycarbonyl-5,5-dimethyl-2H-thiophene-4-carboxylic acid
InChIKeyVVWNLHGQSPEKEH-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C(SC1)(C)C)C(=O)O

Computed by PubChem (NCBI)