CAS 2894-61-3 appears in our catalog under these names: 7-Bromo-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-one, >95% (HPLC), Desalkylgidazepam, 7-Bromo-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-one. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 1mg, 5mg, 1g, 5 mg, 1 mg.
7-bromo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 2894-61-3) is a chemical compound with the molecular formula C15H11BrN2O and a molecular weight of 315.16 g/mol. IUPAC name: 7-bromo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: ATCCWKYKHCKDGT-UHFFFAOYSA-N.
| Molecular formula | C15H11BrN2O |
|---|---|
| Molecular weight | 315.16 g/mol |
| IUPAC name | 7-bromo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | ATCCWKYKHCKDGT-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C=C(C=C2)Br)C(=N1)C3=CC=CC=C3 |
Computed by PubChem (NCBI)