CAS 2894-68-0 appears in our catalog under these names: Chlorodiazepam, Diclazepam, Diclazepam 1.0 mg/ml in Methanol. Offered by: TRC, LoGiCal. Available pack sizes: 250mg, 10mg, 1ml.
7-chloro-5-(2-chlorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one (CAS 2894-68-0) is a chemical compound with the molecular formula C16H12Cl2N2O and a molecular weight of 319.2 g/mol. IUPAC name: 7-chloro-5-(2-chlorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one. InChIKey: VPAYQWRBBOGGPY-UHFFFAOYSA-N.
| Molecular formula | C16H12Cl2N2O |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | 7-chloro-5-(2-chlorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one |
| InChIKey | VPAYQWRBBOGGPY-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CN=C(C2=C1C=CC(=C2)Cl)C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)